CAS 2680660-26-6 is the registry number for Benzyl (3-(chlorosulfonyl)-5-methylpyridin-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-(3-chlorosulfonyl-5-methyl-2-pyridinyl)carbamate (CAS 2680660-26-6) is a chemical compound with the molecular formula C14H13ClN2O4S and a molecular weight of 340.8 g/mol. IUPAC name: benzyl N-(3-chlorosulfonyl-5-methyl-2-pyridinyl)carbamate. InChIKey: PODMDVOGURBRDT-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O4S |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | benzyl N-(3-chlorosulfonyl-5-methyl-2-pyridinyl)carbamate |
| InChIKey | PODMDVOGURBRDT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)NC(=O)OCC2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)