Products 1193390-00-9
CAS 1193390-00-9 is the registry number for Methyl 5-(4-aminobenzenesulfonamido)-2-chlorobenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 5-[(4-aminophenyl)sulfonylamino]-2-chlorobenzoate (CAS 1193390-00-9) is a chemical compound with the molecular formula C14H13ClN2O4S and a molecular weight of 340.8 g/mol. IUPAC name: methyl 5-[(4-aminophenyl)sulfonylamino]-2-chlorobenzoate. InChIKey: HUSQHYVRBXIJLR-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O4S |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | methyl 5-[(4-aminophenyl)sulfonylamino]-2-chlorobenzoate |
| InChIKey | HUSQHYVRBXIJLR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N)Cl |
Computed by PubChem (NCBI)