CAS 1023947-94-5 appears in our catalog under these names: 1-((3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)-4-methylpiperidine, 95%, 1-((3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)-4-methylpiperidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylpiperidine (CAS 1023947-94-5) is a chemical compound with the molecular formula C11H19N3O2S and a molecular weight of 257.35 g/mol. IUPAC name: 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylpiperidine. InChIKey: CCSQZNBZBSKIIL-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2S |
|---|---|
| Molecular weight | 257.35 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylpiperidine |
| InChIKey | CCSQZNBZBSKIIL-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=C(NN=C2C)C |
Computed by PubChem (NCBI)