CAS 956437-74-4 is the registry number for 3-(3,5-Dimethyl-4-((methylamino)methyl)-1H-pyrazol-1-yl)tetrahydrothiophene 1,1-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-N-methylmethanamine (CAS 956437-74-4) is a chemical compound with the molecular formula C11H19N3O2S and a molecular weight of 257.35 g/mol. IUPAC name: 1-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-N-methylmethanamine. InChIKey: BYYKHXCNLUDEOJ-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2S |
|---|---|
| Molecular weight | 257.35 g/mol |
| IUPAC name | 1-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-N-methylmethanamine |
| InChIKey | BYYKHXCNLUDEOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2CCS(=O)(=O)C2)C)CNC |
Computed by PubChem (NCBI)