CAS 956571-71-4 is the registry number for 3-(5-Amino-3-(tert-butyl)-1H-pyrazol-1-yl)tetrahydrothiophene 1,1-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-tert-butyl-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine (CAS 956571-71-4) is a chemical compound with the molecular formula C11H19N3O2S and a molecular weight of 257.35 g/mol. IUPAC name: 3-tert-butyl-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine. InChIKey: WQFAYWXQQKDDJF-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2S |
|---|---|
| Molecular weight | 257.35 g/mol |
| IUPAC name | 3-tert-butyl-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
| InChIKey | WQFAYWXQQKDDJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)