CAS 1281984-44-8 appears in our catalog under these names: 5-(Chloromethyl)-1-(2,2,2-trifluoroethyl)-1h-pyrazole, 95%, 5-(Chloromethyl)-1-(2,2,2-trifluoroethyl)-1H-pyrazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
5-(chloromethyl)-1-(2,2,2-trifluoroethyl)pyrazole (CAS 1281984-44-8) is a chemical compound with the molecular formula C6H6ClF3N2 and a molecular weight of 198.57 g/mol. IUPAC name: 5-(chloromethyl)-1-(2,2,2-trifluoroethyl)pyrazole. InChIKey: HAKYEXHJXOSYEH-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 5-(chloromethyl)-1-(2,2,2-trifluoroethyl)pyrazole |
| InChIKey | HAKYEXHJXOSYEH-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CC(F)(F)F)CCl |
Computed by PubChem (NCBI)