CAS 1024038-72-9 appears in our catalog under these names: Methyl (1r,5s,6r)-3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride, 95%, rel-(1R,5S,6r)-Methyl 3-azabicyclo(3.1.0)hexane-6-carboxylate, 97%, 3-Azabicyclo[3.1.0]hexane-6-carboxylic acid, methyl ester, (1α,5α,6α)-, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate;hydrochloride (CAS 1024038-72-9) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate;hydrochloride. InChIKey: FINRNZAMIJPDPU-FTEHNKOGSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate;hydrochloride |
| InChIKey | FINRNZAMIJPDPU-FTEHNKOGSA-N |
| SMILES | COC(=O)C1[C@H]2[C@@H]1CNC2.Cl |
Computed by PubChem (NCBI)