CAS 1212063-26-7 appears in our catalog under these names: rac-methyl (1R,5S,6R)-3-azabicyclo(3.1.0)hexane-6-carboxylate hydrochloride, methyl rac-(1R,5S,6r)-3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride, 97%, 97%, Methyl (1R,5S,6r)-3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride, 95%, rel-(1R,5S,6r)-Methyl 3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 500mg, 1g, 10g, 25g.
Methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate;hydrochloride (CAS 1212063-26-7) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate;hydrochloride. InChIKey: FINRNZAMIJPDPU-FTEHNKOGSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | methyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate;hydrochloride |
| InChIKey | FINRNZAMIJPDPU-FTEHNKOGSA-N |
| SMILES | COC(=O)C1[C@H]2[C@@H]1CNC2.Cl |
Computed by PubChem (NCBI)