CAS 1024040-62-7 is the registry number for 2,2-dimethyl-7-((4-nitrophenyl)methoxy)oxaindane. Offered by: Biosynth. Available pack sizes: 250mg.
2,2-dimethyl-7-[(4-nitrophenyl)methoxy]-3H-1-benzofuran (CAS 1024040-62-7) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: 2,2-dimethyl-7-[(4-nitrophenyl)methoxy]-3H-1-benzofuran. InChIKey: KLNTUEGUXALRFE-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 2,2-dimethyl-7-[(4-nitrophenyl)methoxy]-3H-1-benzofuran |
| InChIKey | KLNTUEGUXALRFE-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)OCC3=CC=C(C=C3)[N+](=O)[O-])C |
Computed by PubChem (NCBI)