Products 1024151-75-4
CAS 1024151-75-4 is the registry number for methyl 3-(methoxycarbonyl)-2-((phenylcyclopentyl)carbonylamino)benzoate. Offered by: Biosynth. Available pack sizes: 250mg.
Dimethyl 2-[(1-phenylcyclopentanecarbonyl)amino]benzene-1,3-dicarboxylate (CAS 1024151-75-4) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: dimethyl 2-[(1-phenylcyclopentanecarbonyl)amino]benzene-1,3-dicarboxylate. InChIKey: YSFNGHLIAGDGQS-UHFFFAOYSA-N.
| Molecular formula | C22H23NO5 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | dimethyl 2-[(1-phenylcyclopentanecarbonyl)amino]benzene-1,3-dicarboxylate |
| InChIKey | YSFNGHLIAGDGQS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(=O)OC)NC(=O)C2(CCCC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)