Products 1024222-56-7
CAS 1024222-56-7 appears in our catalog under these names: 1-(3,4-dimethoxyphenyl)-2,6,6-trimethyl-5,6,7-trihydroindol-4-one, 1-(3,4-Dimethoxyphenyl)-2,6,6-trimethyl-4,5,6,7-tetrahydro-1H-indol-4-one, ≥95%, ≥95%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 1g.
1-(3,4-dimethoxyphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (CAS 1024222-56-7) is a chemical compound with the molecular formula C19H23NO3 and a molecular weight of 313.4 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one. InChIKey: ZGNPBZFPYVFIAY-UHFFFAOYSA-N.
| Molecular formula | C19H23NO3 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| InChIKey | ZGNPBZFPYVFIAY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC(=C(C=C3)OC)OC)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)