CAS 1024240-49-0 is the registry number for N-(2,3-dihydro-1H-inden-5-yl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2,3-dihydro-1H-inden-5-yl)-1-phenylcyclopentane-1-carboxamide (CAS 1024240-49-0) is a chemical compound with the molecular formula C21H23NO and a molecular weight of 305.4 g/mol. IUPAC name: N-(2,3-dihydro-1H-inden-5-yl)-1-phenylcyclopentane-1-carboxamide. InChIKey: WNOUEIGNDPMVRH-UHFFFAOYSA-N.
| Molecular formula | C21H23NO |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | N-(2,3-dihydro-1H-inden-5-yl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | WNOUEIGNDPMVRH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC4=C(CCC4)C=C3 |
Computed by PubChem (NCBI)