Products 119357-39-0
CAS 119357-39-0 appears in our catalog under these names: Dapoxetine Impurity 4, Dapoxetine Impurity 8, Dapoxetine Impurity 4 HCl, Dapoxetine Impurity 8 HCl. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N,N-dimethyl-3-naphthalen-2-yloxy-1-phenylpropan-1-amine (CAS 119357-39-0) is a chemical compound with the molecular formula C21H23NO and a molecular weight of 305.4 g/mol. IUPAC name: N,N-dimethyl-3-naphthalen-2-yloxy-1-phenylpropan-1-amine. InChIKey: CWLFFSMYYURBLY-UHFFFAOYSA-N.
| Molecular formula | C21H23NO |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | N,N-dimethyl-3-naphthalen-2-yloxy-1-phenylpropan-1-amine |
| InChIKey | CWLFFSMYYURBLY-UHFFFAOYSA-N |
| SMILES | CN(C)C(CCOC1=CC2=CC=CC=C2C=C1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)