Products 333325-96-5

CAS 333325-96-5 is the registry number for WAY-114228, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

5-(4-methylphenyl)-3-(2-phenylethylamino)cyclohex-2-en-1-one (CAS 333325-96-5) is a chemical compound with the molecular formula C21H23NO and a molecular weight of 305.4 g/mol. IUPAC name: 5-(4-methylphenyl)-3-(2-phenylethylamino)cyclohex-2-en-1-one. InChIKey: ALZVXGOQCYTHEU-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO
Molecular weight305.4 g/mol
IUPAC name5-(4-methylphenyl)-3-(2-phenylethylamino)cyclohex-2-en-1-one
InChIKeyALZVXGOQCYTHEU-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2CC(=CC(=O)C2)NCCC3=CC=CC=C3

Computed by PubChem (NCBI)