Products 102434-73-1
CAS 102434-73-1 is the registry number for 2,6-Diamino-4-phenyl-4h-thiopyran-3,5-dicarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,6-diamino-4-phenyl-4H-thiopyran-3,5-dicarbonitrile (CAS 102434-73-1) is a chemical compound with the molecular formula C13H10N4S and a molecular weight of 254.31 g/mol. IUPAC name: 2,6-diamino-4-phenyl-4H-thiopyran-3,5-dicarbonitrile. InChIKey: JAMKVNSBEKQPQS-UHFFFAOYSA-N.
| Molecular formula | C13H10N4S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 2,6-diamino-4-phenyl-4H-thiopyran-3,5-dicarbonitrile |
| InChIKey | JAMKVNSBEKQPQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=C(SC(=C2C#N)N)N)C#N |
Computed by PubChem (NCBI)