CAS 57600-03-0 is the registry number for 4-Phenyl-5-pyridin-3-yl-4h-[1,2,4]triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-phenyl-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione (CAS 57600-03-0) is a chemical compound with the molecular formula C13H10N4S and a molecular weight of 254.31 g/mol. IUPAC name: 4-phenyl-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione. InChIKey: MXPQWTUKCULYHR-UHFFFAOYSA-N.
| Molecular formula | C13H10N4S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 4-phenyl-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | MXPQWTUKCULYHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)C3=CN=CC=C3 |
Computed by PubChem (NCBI)