CAS 35356-56-0 appears in our catalog under these names: N-Phenyl-5-(pyridin-3-yl)-1,3,4-thiadiazol-2-amine, 95%, 95%, N-Phenyl-5-(pyridin-3-yl)-1,3,4-thiadiazol-2-amine, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
N-phenyl-5-pyridin-3-yl-1,3,4-thiadiazol-2-amine (CAS 35356-56-0) is a chemical compound with the molecular formula C13H10N4S and a molecular weight of 254.31 g/mol. IUPAC name: N-phenyl-5-pyridin-3-yl-1,3,4-thiadiazol-2-amine. InChIKey: MEZDSYWXAWCEEH-UHFFFAOYSA-N.
| Molecular formula | C13H10N4S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | N-phenyl-5-pyridin-3-yl-1,3,4-thiadiazol-2-amine |
| InChIKey | MEZDSYWXAWCEEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NN=C(S2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)