CAS 1024351-82-3 is the registry number for 4-(5-chloro-2-methylphenyl)piperazinyl 2-phenoxy(3-pyridyl) ketone. Offered by: Biosynth. Available pack sizes: 250mg.
[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(2-phenoxy-3-pyridinyl)methanone (CAS 1024351-82-3) is a chemical compound with the molecular formula C23H22ClN3O2 and a molecular weight of 407.9 g/mol. IUPAC name: [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(2-phenoxy-3-pyridinyl)methanone. InChIKey: QFWNHGJVYQWNDU-UHFFFAOYSA-N.
| Molecular formula | C23H22ClN3O2 |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(2-phenoxy-3-pyridinyl)methanone |
| InChIKey | QFWNHGJVYQWNDU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C(=O)C3=C(N=CC=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)