Products 2089099-00-1
CAS 2089099-00-1 is the registry number for Nileblueacrylamide,, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 10mg, 50mg.
Diethyl-[5-(prop-2-enoylamino)benzo[a]phenoxazin-9-ylidene]azanium chloride (CAS 2089099-00-1) is a chemical compound with the molecular formula C23H22ClN3O2 and a molecular weight of 407.9 g/mol. IUPAC name: diethyl-[5-(prop-2-enoylamino)benzo[a]phenoxazin-9-ylidene]azanium chloride. InChIKey: DSLXBAJBQIYISM-UHFFFAOYSA-N.
| Molecular formula | C23H22ClN3O2 |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | diethyl-[5-(prop-2-enoylamino)benzo[a]phenoxazin-9-ylidene]azanium chloride |
| InChIKey | DSLXBAJBQIYISM-UHFFFAOYSA-N |
| SMILES | CC[N+](=C1C=CC2=NC3=C(C=C(C4=CC=CC=C43)NC(=O)C=C)OC2=C1)CC.[Cl-] |
Computed by PubChem (NCBI)