Products 1024391-54-5
CAS 1024391-54-5 is the registry number for (((4-bromonaphthyl)amino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[[(4-bromonaphthalen-1-yl)amino]methylidene]propanedinitrile (CAS 1024391-54-5) is a chemical compound with the molecular formula C14H8BrN3 and a molecular weight of 298.14 g/mol. IUPAC name: 2-[[(4-bromonaphthalen-1-yl)amino]methylidene]propanedinitrile. InChIKey: WRVIWEJKSNYILZ-UHFFFAOYSA-N.
| Molecular formula | C14H8BrN3 |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 2-[[(4-bromonaphthalen-1-yl)amino]methylidene]propanedinitrile |
| InChIKey | WRVIWEJKSNYILZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)NC=C(C#N)C#N |
Computed by PubChem (NCBI)