CAS 1545490-46-7 is the registry number for 3-(6-Bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile (CAS 1545490-46-7) is a chemical compound with the molecular formula C14H8BrN3 and a molecular weight of 298.14 g/mol. IUPAC name: 3-(6-bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile. InChIKey: SHRKMDVMFJNJLG-UHFFFAOYSA-N.
| Molecular formula | C14H8BrN3 |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 3-(6-bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile |
| InChIKey | SHRKMDVMFJNJLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CN3C=C(C=CC3=N2)Br)C#N |
Computed by PubChem (NCBI)