CAS 1552498-44-8 is the registry number for 4-(8-Bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(8-bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile (CAS 1552498-44-8) is a chemical compound with the molecular formula C14H8BrN3 and a molecular weight of 298.14 g/mol. IUPAC name: 4-(8-bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile. InChIKey: GAVXGVGIXCUSFW-UHFFFAOYSA-N.
| Molecular formula | C14H8BrN3 |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 4-(8-bromoimidazo[1,2-a]pyridin-2-yl)benzonitrile |
| InChIKey | GAVXGVGIXCUSFW-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C(=C1)Br)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)