CAS 1024400-43-8 is the registry number for 2-chloro-3-((2-methyl-5-(isopropyl)phenyl)amino)-5-phenylcyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-chloro-3-(2-methyl-5-propan-2-ylanilino)-5-phenylcyclohex-2-en-1-one (CAS 1024400-43-8) is a chemical compound with the molecular formula C22H24ClNO and a molecular weight of 353.9 g/mol. IUPAC name: 2-chloro-3-(2-methyl-5-propan-2-ylanilino)-5-phenylcyclohex-2-en-1-one. InChIKey: IJNXKRWAEIBZLR-UHFFFAOYSA-N.
| Molecular formula | C22H24ClNO |
|---|---|
| Molecular weight | 353.9 g/mol |
| IUPAC name | 2-chloro-3-(2-methyl-5-propan-2-ylanilino)-5-phenylcyclohex-2-en-1-one |
| InChIKey | IJNXKRWAEIBZLR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)C)NC2=C(C(=O)CC(C2)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)