CAS 102449-89-8 appears in our catalog under these names: 3,3'-Dithiobis(4-aminobenzoic acid), 95%, 3,3'–DITHIOBIS(4–AMINOBENZOIC ACID), 3,3'-Disulfanediylbis(4-aminobenzoic acid), 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-amino-3-[(2-amino-5-carboxyphenyl)disulfanyl]benzoic acid (CAS 102449-89-8) is a chemical compound with the molecular formula C14H12N2O4S2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-amino-3-[(2-amino-5-carboxyphenyl)disulfanyl]benzoic acid. InChIKey: JDRRJHFHSIBHDM-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4S2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-amino-3-[(2-amino-5-carboxyphenyl)disulfanyl]benzoic acid |
| InChIKey | JDRRJHFHSIBHDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)SSC2=C(C=CC(=C2)C(=O)O)N)N |
Computed by PubChem (NCBI)