Products 102449-89-8

CAS 102449-89-8 appears in our catalog under these names: 3,3'-Dithiobis(4-aminobenzoic acid), 95%, 3,3'–DITHIOBIS(4–AMINOBENZOIC ACID), 3,3'-Disulfanediylbis(4-aminobenzoic acid), 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-amino-3-[(2-amino-5-carboxyphenyl)disulfanyl]benzoic acid (CAS 102449-89-8) is a chemical compound with the molecular formula C14H12N2O4S2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-amino-3-[(2-amino-5-carboxyphenyl)disulfanyl]benzoic acid. InChIKey: JDRRJHFHSIBHDM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N2O4S2
Molecular weight336.4 g/mol
IUPAC name4-amino-3-[(2-amino-5-carboxyphenyl)disulfanyl]benzoic acid
InChIKeyJDRRJHFHSIBHDM-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)SSC2=C(C=CC(=C2)C(=O)O)N)N

Computed by PubChem (NCBI)