CAS 35350-31-3 is the registry number for 2-Nitro-p-tolyl disulfide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-methyl-1-[(4-methyl-2-nitrophenyl)disulfanyl]-2-nitrobenzene (CAS 35350-31-3) is a chemical compound with the molecular formula C14H12N2O4S2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-methyl-1-[(4-methyl-2-nitrophenyl)disulfanyl]-2-nitrobenzene. InChIKey: MBTLEECRJWKPIP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4S2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-methyl-1-[(4-methyl-2-nitrophenyl)disulfanyl]-2-nitrobenzene |
| InChIKey | MBTLEECRJWKPIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SSC2=C(C=C(C=C2)C)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)