CAS 1024572-86-8 is the registry number for methyl 2-(((benzo(d)1,3-dioxolan-5-ylamino)thioxomethyl)amino)thiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 2-(1,3-benzodioxol-5-ylcarbamothioylamino)thiophene-3-carboxylate (CAS 1024572-86-8) is a chemical compound with the molecular formula C14H12N2O4S2 and a molecular weight of 336.4 g/mol. IUPAC name: methyl 2-(1,3-benzodioxol-5-ylcarbamothioylamino)thiophene-3-carboxylate. InChIKey: RGYLLUMQAVYPRE-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4S2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | methyl 2-(1,3-benzodioxol-5-ylcarbamothioylamino)thiophene-3-carboxylate |
| InChIKey | RGYLLUMQAVYPRE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=C1)NC(=S)NC2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)