Products 1024877-29-9
CAS 1024877-29-9 is the registry number for 2-amino-1-(1-aza-2-benzo(3,4-d)1,3-dioxolen-5-ylvinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-amino-3-(1,3-benzodioxol-5-ylmethylideneamino)but-2-enedinitrile (CAS 1024877-29-9) is a chemical compound with the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. IUPAC name: (Z)-2-amino-3-(1,3-benzodioxol-5-ylmethylideneamino)but-2-enedinitrile. InChIKey: ZYSQXVMPLJKAOJ-MGHZFKQTSA-N.
| Molecular formula | C12H8N4O2 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | (Z)-2-amino-3-(1,3-benzodioxol-5-ylmethylideneamino)but-2-enedinitrile |
| InChIKey | ZYSQXVMPLJKAOJ-MGHZFKQTSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)