Products 2045896-88-4

CAS 2045896-88-4 is the registry number for 6-(2H-Tetrazol-5-yl)-2-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-(2H-tetrazol-5-yl)naphthalene-2-carboxylic acid (CAS 2045896-88-4) is a chemical compound with the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. IUPAC name: 6-(2H-tetrazol-5-yl)naphthalene-2-carboxylic acid. InChIKey: ZEVLTFGVHKYVLM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8N4O2
Molecular weight240.22 g/mol
IUPAC name6-(2H-tetrazol-5-yl)naphthalene-2-carboxylic acid
InChIKeyZEVLTFGVHKYVLM-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2)C(=O)O)C=C1C3=NNN=N3

Computed by PubChem (NCBI)