CAS 1239787-61-1 is the registry number for 3-(3-Pyridin-4-yl-1,2,4-oxadiazol-5-yl)pyridin-2(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one (CAS 1239787-61-1) is a chemical compound with the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. IUPAC name: 3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one. InChIKey: RRMYAZNBQAOEQY-UHFFFAOYSA-N.
| Molecular formula | C12H8N4O2 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | 3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one |
| InChIKey | RRMYAZNBQAOEQY-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C(=C1)C2=NC(=NO2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)