CAS 1025026-56-5 appears in our catalog under these names: 1',5'-Dimethyl-1'h,2h-3,4'-bipyrazol-5-amine, 95%, 1',5'-Dimethyl-1H,1'H-3,4'-bipyrazol-5-amine, 95%, 1',5'-Dimethyl-1'H,2H-(3,4'-bipyrazol)-5-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
5-(1,5-dimethylpyrazol-4-yl)-1H-pyrazol-3-amine (CAS 1025026-56-5) is a chemical compound with the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. IUPAC name: 5-(1,5-dimethylpyrazol-4-yl)-1H-pyrazol-3-amine. InChIKey: QBBDCDGFVCFUJV-UHFFFAOYSA-N.
| Molecular formula | C8H11N5 |
|---|---|
| Molecular weight | 177.21 g/mol |
| IUPAC name | 5-(1,5-dimethylpyrazol-4-yl)-1H-pyrazol-3-amine |
| InChIKey | QBBDCDGFVCFUJV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C2=CC(=NN2)N |
Computed by PubChem (NCBI)