CAS 200884-04-4 is the registry number for 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,7-dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine (CAS 200884-04-4) is a chemical compound with the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. IUPAC name: 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine. InChIKey: UWPZIUVTJBGBCD-UHFFFAOYSA-N.
| Molecular formula | C8H11N5 |
|---|---|
| Molecular weight | 177.21 g/mol |
| IUPAC name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine |
| InChIKey | UWPZIUVTJBGBCD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C(C(=NN12)N)N)C |
Computed by PubChem (NCBI)