CAS 85599-36-6 is the registry number for 6-Isopropyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CAS 85599-36-6) is a chemical compound with the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. IUPAC name: 6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine. InChIKey: BLLAHBDMHJFUBZ-UHFFFAOYSA-N.
| Molecular formula | C8H11N5 |
|---|---|
| Molecular weight | 177.21 g/mol |
| IUPAC name | 6-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| InChIKey | BLLAHBDMHJFUBZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CN2C(=NC(=N2)N)N=C1 |
Computed by PubChem (NCBI)