CAS 102507-85-7 is the registry number for Aztreonam Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(Z)-[(2-amino-1,3-thiazol-4-yl)-carboxymethylidene]amino]oxy-2-methylpropanoic acid (CAS 102507-85-7) is a chemical compound with the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. IUPAC name: 2-[(Z)-[(2-amino-1,3-thiazol-4-yl)-carboxymethylidene]amino]oxy-2-methylpropanoic acid. InChIKey: VNCBMEHASYISTH-XGICHPGQSA-N.
| Molecular formula | C9H11N3O5S |
|---|---|
| Molecular weight | 273.27 g/mol |
| IUPAC name | 2-[(Z)-[(2-amino-1,3-thiazol-4-yl)-carboxymethylidene]amino]oxy-2-methylpropanoic acid |
| InChIKey | VNCBMEHASYISTH-XGICHPGQSA-N |
| SMILES | CC(C)(C(=O)O)O/N=C(/C1=CSC(=N1)N)\C(=O)O |
Computed by PubChem (NCBI)