CAS 37051-07-3 appears in our catalog under these names: Cefuroxime Axetil Impurity 7, Cefoxitin Impurity 14, (7R)-7-Amino Cefoxitin(Cefoxitin Impurity J). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-7-amino-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 37051-07-3) is a chemical compound with the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. IUPAC name: (6R,7R)-7-amino-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: ZJIANJKJAAXAOC-CLZZGJSISA-N.
| Molecular formula | C9H11N3O5S |
|---|---|
| Molecular weight | 273.27 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | ZJIANJKJAAXAOC-CLZZGJSISA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)COC(=O)N |
Computed by PubChem (NCBI)