CAS 190520-68-4 is the registry number for N,N-Dimethyl-4-nitro-2-sulfamoylbenzamide. Offered by: TRC. Available pack sizes: 250mg.
N,N-dimethyl-4-nitro-2-sulfamoylbenzamide (CAS 190520-68-4) is a chemical compound with the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. IUPAC name: N,N-dimethyl-4-nitro-2-sulfamoylbenzamide. InChIKey: VTOWSZKEPNGZRY-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O5S |
|---|---|
| Molecular weight | 273.27 g/mol |
| IUPAC name | N,N-dimethyl-4-nitro-2-sulfamoylbenzamide |
| InChIKey | VTOWSZKEPNGZRY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)