CAS 1025097-50-0 is the registry number for (R)-3-(3-Fluoro-4-hydroxyphenyl)-5-(hydroxymethyl)oxazolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-3-(3-fluoro-4-hydroxyphenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 1025097-50-0) is a chemical compound with the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. IUPAC name: (5R)-3-(3-fluoro-4-hydroxyphenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: UECIVZGOGAPDAQ-SSDOTTSWSA-N.
| Molecular formula | C10H10FNO4 |
|---|---|
| Molecular weight | 227.19 g/mol |
| IUPAC name | (5R)-3-(3-fluoro-4-hydroxyphenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | UECIVZGOGAPDAQ-SSDOTTSWSA-N |
| SMILES | C1[C@@H](OC(=O)N1C2=CC(=C(C=C2)O)F)CO |
Computed by PubChem (NCBI)