Products 2892093-08-0

CAS 2892093-08-0 is the registry number for 2-(5-Fluoro-2-methyl-4-nitrophenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5-fluoro-2-methyl-4-nitrophenyl)propanoic acid (CAS 2892093-08-0) is a chemical compound with the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. IUPAC name: 2-(5-fluoro-2-methyl-4-nitrophenyl)propanoic acid. InChIKey: BVPYZVKTUISLNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10FNO4
Molecular weight227.19 g/mol
IUPAC name2-(5-fluoro-2-methyl-4-nitrophenyl)propanoic acid
InChIKeyBVPYZVKTUISLNJ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C(C)C(=O)O)F)[N+](=O)[O-]

Computed by PubChem (NCBI)