CAS 1160623-38-0 is the registry number for Ethyl 2-(2-fluoro-4-nitrophenyl)acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Ethyl 2-(2-fluoro-4-nitrophenyl)acetate (CAS 1160623-38-0) is a chemical compound with the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. IUPAC name: ethyl 2-(2-fluoro-4-nitrophenyl)acetate. InChIKey: OMYSNVCRTKUTTK-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO4 |
|---|---|
| Molecular weight | 227.19 g/mol |
| IUPAC name | ethyl 2-(2-fluoro-4-nitrophenyl)acetate |
| InChIKey | OMYSNVCRTKUTTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)