Products 1025165-66-5
CAS 1025165-66-5 is the registry number for 2-((2-nitrilo-3-oxo-3-phenylprop-1-enyl)amino)-6-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-[[(Z)-2-cyano-3-oxo-3-phenylprop-1-enyl]amino]-6-methylbenzoic acid (CAS 1025165-66-5) is a chemical compound with the molecular formula C18H14N2O3 and a molecular weight of 306.3 g/mol. IUPAC name: 2-[[(Z)-2-cyano-3-oxo-3-phenylprop-1-enyl]amino]-6-methylbenzoic acid. InChIKey: GPAKJBDPKRHIHP-KAMYIIQDSA-N.
| Molecular formula | C18H14N2O3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 2-[[(Z)-2-cyano-3-oxo-3-phenylprop-1-enyl]amino]-6-methylbenzoic acid |
| InChIKey | GPAKJBDPKRHIHP-KAMYIIQDSA-N |
| SMILES | CC1=C(C(=CC=C1)N/C=C(/C#N)\C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)