CAS 54009-54-0 appears in our catalog under these names: SD49-7/ 99.36% (existing batch purity), 2-Hydroxy-N'-((2-hydroxynaphthalen-1-yl)methylene)benzohydrazide, 95%, 95%, (E/Z)-NSAH. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 25 mg.
2-hydroxy-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide (CAS 54009-54-0) is a chemical compound with the molecular formula C18H14N2O3 and a molecular weight of 306.3 g/mol. IUPAC name: 2-hydroxy-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide. InChIKey: ZZSJOLDICPVVAV-YBFXNURJSA-N.
| Molecular formula | C18H14N2O3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 2-hydroxy-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
| InChIKey | ZZSJOLDICPVVAV-YBFXNURJSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2/C=N/NC(=O)C3=CC=CC=C3O)O |
Computed by PubChem (NCBI)