Products 222626-23-5
CAS 222626-23-5 is the registry number for 3-(3,4-dimethoxyphenyl)indeno(2,3-d)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
3-(3,4-dimethoxyphenyl)-1H-indeno[2,1-d]pyrazol-4-one (CAS 222626-23-5) is a chemical compound with the molecular formula C18H14N2O3 and a molecular weight of 306.3 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1H-indeno[2,1-d]pyrazol-4-one. InChIKey: PNINMJPGKISUFN-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1H-indeno[2,1-d]pyrazol-4-one |
| InChIKey | PNINMJPGKISUFN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NNC3=C2C(=O)C4=CC=CC=C43)OC |
Computed by PubChem (NCBI)