CAS 10253-83-5 appears in our catalog under these names: 5-(Phenylamino)-1,3,4-thiadiazole-2-thiol, 2-Mercapto-5-anilino-1,3,4-thiadiazole, 95%, 5-(Phenylamino)-1,3,4-thiadiazole-2(3H)-thione, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
5-anilino-3H-1,3,4-thiadiazole-2-thione (CAS 10253-83-5) is a chemical compound with the molecular formula C8H7N3S2 and a molecular weight of 209.3 g/mol. IUPAC name: 5-anilino-3H-1,3,4-thiadiazole-2-thione. InChIKey: BOJLJKMUGYYKCZ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S2 |
|---|---|
| Molecular weight | 209.3 g/mol |
| IUPAC name | 5-anilino-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | BOJLJKMUGYYKCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)