CAS 18519-26-1 is the registry number for 2,5-Dimethyl-3,4-dithiocyanato-1H-pyrrole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,5-dimethyl-4-thiocyanato-1H-pyrrol-3-yl) thiocyanate (CAS 18519-26-1) is a chemical compound with the molecular formula C8H7N3S2 and a molecular weight of 209.3 g/mol. IUPAC name: (2,5-dimethyl-4-thiocyanato-1H-pyrrol-3-yl) thiocyanate. InChIKey: OWYPIPRFVLLAID-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S2 |
|---|---|
| Molecular weight | 209.3 g/mol |
| IUPAC name | (2,5-dimethyl-4-thiocyanato-1H-pyrrol-3-yl) thiocyanate |
| InChIKey | OWYPIPRFVLLAID-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N1)C)SC#N)SC#N |
Computed by PubChem (NCBI)