CAS 879906-47-5 is the registry number for 5-(2-(Thiophen-2-yl)ethenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(E)-2-thiophen-2-ylethenyl]-1,2-dihydro-1,2,4-triazole-3-thione (CAS 879906-47-5) is a chemical compound with the molecular formula C8H7N3S2 and a molecular weight of 209.3 g/mol. IUPAC name: 5-[(E)-2-thiophen-2-ylethenyl]-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: ZSJRVSLDYPQLLA-ONEGZZNKSA-N.
| Molecular formula | C8H7N3S2 |
|---|---|
| Molecular weight | 209.3 g/mol |
| IUPAC name | 5-[(E)-2-thiophen-2-ylethenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | ZSJRVSLDYPQLLA-ONEGZZNKSA-N |
| SMILES | C1=CSC(=C1)/C=C/C2=NC(=S)NN2 |
Computed by PubChem (NCBI)