Products 1025667-34-8
CAS 1025667-34-8 is the registry number for N-(aza(3-oxocyclohexylidene)methyl)-2-((4-methylphenyl)sulfonyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-methylphenyl)sulfonyl-N-[(Z)-(3-oxocyclohexylidene)amino]acetamide (CAS 1025667-34-8) is a chemical compound with the molecular formula C15H18N2O4S and a molecular weight of 322.4 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyl-N-[(Z)-(3-oxocyclohexylidene)amino]acetamide. InChIKey: IEPHBQZTAFZKGJ-VBKFSLOCSA-N.
| Molecular formula | C15H18N2O4S |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyl-N-[(Z)-(3-oxocyclohexylidene)amino]acetamide |
| InChIKey | IEPHBQZTAFZKGJ-VBKFSLOCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)N/N=C\2/CCCC(=O)C2 |
Computed by PubChem (NCBI)