Products 2287344-14-1
CAS 2287344-14-1 is the registry number for tert-Butyl N-(6-sulfamoylnaphthalen-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-(6-sulfamoylnaphthalen-2-yl)carbamate (CAS 2287344-14-1) is a chemical compound with the molecular formula C15H18N2O4S and a molecular weight of 322.4 g/mol. IUPAC name: tert-butyl N-(6-sulfamoylnaphthalen-2-yl)carbamate. InChIKey: WPYWNEXTEQWCMQ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4S |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | tert-butyl N-(6-sulfamoylnaphthalen-2-yl)carbamate |
| InChIKey | WPYWNEXTEQWCMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(C=C1)C=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)