CAS 36257-55-3 appears in our catalog under these names: 2-[2-(piperidine-1-sulfonyl)ethyl]isoindole-1,3-dione, 97%, 2-[2-(Piperidin-1-ylsulfonyl)ethyl]-1h-isoindole-1,3(2h)-dione, 95%, 2-(2-(Piperidin-1-ylsulfonyl)ethyl)isoindoline-1,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g', 250mg, 1g, 10g.
2-(2-piperidin-1-ylsulfonylethyl)isoindole-1,3-dione (CAS 36257-55-3) is a chemical compound with the molecular formula C15H18N2O4S and a molecular weight of 322.4 g/mol. IUPAC name: 2-(2-piperidin-1-ylsulfonylethyl)isoindole-1,3-dione. InChIKey: XXJZMAPQYRMERJ-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4S |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 2-(2-piperidin-1-ylsulfonylethyl)isoindole-1,3-dione |
| InChIKey | XXJZMAPQYRMERJ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)CCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)