CAS 1025796-32-0 appears in our catalog under these names: GCPII-IN-1, 95%, GCPII-IN-1, 99.83%, N-[[[(1S)-5-Amino-1-carboxypentyl]amino]carbonyl]-L-glutamic acid, 98%, 98%, GCPII-IN-1, 98%, (((S)-5-Amino-1-carboxypentyl)carbamoyl)-L-glutamic acid, 98% (TFA salt). Offered by: AmBeed, MedChemExpress, Chemat, BLDpharm. Available pack sizes: 25mg, 100 mg, 25 mg, 5 mg, 10 mg, 50 mg, 50mg, 100mg.
(2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoylamino]pentanedioic acid (CAS 1025796-32-0) is a chemical compound with the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. IUPAC name: (2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoylamino]pentanedioic acid. InChIKey: ZZASEPMMGWJWOV-YUMQZZPRSA-N.
| Molecular formula | C12H21N3O7 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | (2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| InChIKey | ZZASEPMMGWJWOV-YUMQZZPRSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)O)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)