Products 592520-07-5

CAS 592520-07-5 is the registry number for iE-DAP. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-amino-6-[[(4R)-4-amino-4-carboxybutanoyl]amino]heptanedioic acid (CAS 592520-07-5) is a chemical compound with the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. IUPAC name: 2-amino-6-[[(4R)-4-amino-4-carboxybutanoyl]amino]heptanedioic acid. InChIKey: QIFGMZZTJRULMA-ZUEIMRROSA-N.

Identity
Molecular formulaC12H21N3O7
Molecular weight319.31 g/mol
IUPAC name2-amino-6-[[(4R)-4-amino-4-carboxybutanoyl]amino]heptanedioic acid
InChIKeyQIFGMZZTJRULMA-ZUEIMRROSA-N
SMILESC(CC(C(=O)O)N)CC(C(=O)O)NC(=O)CC[C@H](C(=O)O)N

Computed by PubChem (NCBI)

Synonyms: orb2277213