CAS 592520-07-5 is the registry number for iE-DAP. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-6-[[(4R)-4-amino-4-carboxybutanoyl]amino]heptanedioic acid (CAS 592520-07-5) is a chemical compound with the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. IUPAC name: 2-amino-6-[[(4R)-4-amino-4-carboxybutanoyl]amino]heptanedioic acid. InChIKey: QIFGMZZTJRULMA-ZUEIMRROSA-N.
| Molecular formula | C12H21N3O7 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | 2-amino-6-[[(4R)-4-amino-4-carboxybutanoyl]amino]heptanedioic acid |
| InChIKey | QIFGMZZTJRULMA-ZUEIMRROSA-N |
| SMILES | C(CC(C(=O)O)N)CC(C(=O)O)NC(=O)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)