Products 1956310-82-9

CAS 1956310-82-9 is the registry number for tert-Butyl 3-amino-3-carbamoylpyrrolidine-1-carboxylate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-amino-3-carbamoylpyrrolidine-1-carboxylate;oxalic acid (CAS 1956310-82-9) is a chemical compound with the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. IUPAC name: tert-butyl 3-amino-3-carbamoylpyrrolidine-1-carboxylate;oxalic acid. InChIKey: RZTZIRCJIVHLFU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21N3O7
Molecular weight319.31 g/mol
IUPAC nametert-butyl 3-amino-3-carbamoylpyrrolidine-1-carboxylate;oxalic acid
InChIKeyRZTZIRCJIVHLFU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C1)(C(=O)N)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)